C26H25N3O4 — CID 129180038
4-[(2S,3R,6R)-2,3-dihydroxy-12-methoxy-4-(methylaminomethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129180038) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[(2S,3R,6R)-2,3-dihydroxy-12-methoxy-4-(methylaminomethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,6R)-2,3-dihydroxy-12-methoxy-4-(methylaminomethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129180038 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-[(2S,3R,6R)-2,3-dihydroxy-12-methoxy-4-(methylaminomethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | CNCC1C(c2ccccc2)[C@]2(c3ccc(C#N)cc3)Oc3cncc(OC)c3[C@]2(O)[C@@H]1O |
| InChI | InChI=1S/C26H25N3O4/c1-28-13-19-22(17-6-4-3-5-7-17)26(18-10-8-16(12-27)9-11-18)25(31,24(19)30)23-20(32-2)14-29-15-21(23)33-26/h3-11,14-15,19,22,24,28,30-31H,13H2,1-2H3/t19?,22?,24-,25+,26+/m1/s1 |
| InChIKey | IPZKVGILYLBCJN-CXGJATNSSA-N |
| XLogP | 2.43 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |