C29H31N3O4 — CID 161354348
(2S,3R,4S,5S,6R)-4-[[cyclopropyl(methyl)amino]methyl]-12-methoxy-5,6-diphenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol;formonitrile (PubChem CID 161354348) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-4-[[cyclopropyl(methyl)amino]methyl]-12-methoxy-5,6-diphenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol;formonitrile.
| Compound Name | (2S,3R,4S,5S,6R)-4-[[cyclopropyl(methyl)amino]methyl]-12-methoxy-5,6-diphenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol;formonitrile |
|---|---|
| PubChem CID | 161354348 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (2S,3R,4S,5S,6R)-4-[[cyclopropyl(methyl)amino]methyl]-12-methoxy-5,6-diphenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol;formonitrile |
| SMILES | C#N.COc1cncc2c1[C@]1(O)[C@H](O)[C@H](CN(C)C3CC3)[C@@H](c3ccccc3)[C@]1(c1ccccc1)O2 |
| InChI | InChI=1S/C28H30N2O4.CHN/c1-30(20-13-14-20)17-21-24(18-9-5-3-6-10-18)28(19-11-7-4-8-12-19)27(32,26(21)31)25-22(33-2)15-29-16-23(25)34-28;1-2/h3-12,15-16,20-21,24,26,31-32H,13-14,17H2,1-2H3;1H/t21-,24-,26-,27+,28+;/m1./s1 |
| InChIKey | VOILEHMUPHNPGZ-YKAKPORASA-N |
| XLogP | 3.57 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |