C28H27N3O4 — CID 129138691
4-[(2S,3R,4S,5S,6R)-4-[(cyclopropylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 129138691) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[(2S,3R,4S,5S,6R)-4-[(cyclopropylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,4S,5S,6R)-4-[(cyclopropylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138691 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[(2S,3R,4S,5S,6R)-4-[(cyclopropylamino)methyl]-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)[C@H](CNC3CC3)[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C28H27N3O4/c1-34-22-15-30-16-23-25(22)27(33)26(32)21(14-31-20-11-12-20)24(18-5-3-2-4-6-18)28(27,35-23)19-9-7-17(13-29)8-10-19/h2-10,15-16,20-21,24,26,31-33H,11-12,14H2,1H3/t21-,24-,26-,27+,28+/m1/s1 |
| InChIKey | VFDNVPMOISIHNE-GBKKCVIMSA-N |
| XLogP | 2.96 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |