C27H29BrN2O5 — CID 145318839
(2R,5S,6R)-6-(4-bromophenyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol;N-(2-hydroxyethyl)-N-methylformamide (PubChem CID 145318839) has the molecular formula C27H29BrN2O5 and a molecular weight of 541.44 g/mol. Its IUPAC name is (2R,5S,6R)-6-(4-bromophenyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol;N-(2-hydroxyethyl)-N-methylformamide.
| Compound Name | (2R,5S,6R)-6-(4-bromophenyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol;N-(2-hydroxyethyl)-N-methylformamide |
|---|---|
| PubChem CID | 145318839 |
| Molecular Formula | C27H29BrN2O5 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | (2R,5S,6R)-6-(4-bromophenyl)-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol;N-(2-hydroxyethyl)-N-methylformamide |
| SMILES | CN(C=O)CCO.COc1cncc2c1[C@]1(O)CC[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C23H20BrNO3.C4H9NO2/c1-27-19-13-25-14-20-21(19)22(26)12-11-18(15-5-3-2-4-6-15)23(22,28-20)16-7-9-17(24)10-8-16;1-5(4-7)2-3-6/h2-10,13-14,18,26H,11-12H2,1H3;4,6H,2-3H2,1H3/t18-,22+,23-;/m0./s1 |
| InChIKey | MSBJDOUQNKMMLB-VZQAYXSHSA-N |
| XLogP | 3.97 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|