C18H20N4 — CID 145320903
3,6-bis(2-methylphenyl)-1,2,4,5-tetrazine;ethane (PubChem CID 145320903) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 3,6-bis(2-methylphenyl)-1,2,4,5-tetrazine;ethane.
| Compound Name | 3,6-bis(2-methylphenyl)-1,2,4,5-tetrazine;ethane |
|---|---|
| PubChem CID | 145320903 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3,6-bis(2-methylphenyl)-1,2,4,5-tetrazine;ethane |
| SMILES | CC.Cc1ccccc1-c1nnc(-c2ccccc2C)nn1 |
| InChI | InChI=1S/C16H14N4.C2H6/c1-11-7-3-5-9-13(11)15-17-19-16(20-18-15)14-10-6-4-8-12(14)2;1-2/h3-10H,1-2H3;1-2H3 |
| InChIKey | OGLLNJNBTYNNOB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |