C24H30N2O7 — CID 145325710
prop-2-enyl 2-methoxy-3-(4-methoxy-4-oxobutoxy)-11-oxospiro[6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,1'-cyclopropane]-5-carboxylate (PubChem CID 145325710) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is prop-2-enyl 2-methoxy-3-(4-methoxy-4-oxobutoxy)-11-oxospiro[6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,1'-cyclopropane]-5-carboxylate.
| Compound Name | prop-2-enyl 2-methoxy-3-(4-methoxy-4-oxobutoxy)-11-oxospiro[6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,1'-cyclopropane]-5-carboxylate |
|---|---|
| PubChem CID | 145325710 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | prop-2-enyl 2-methoxy-3-(4-methoxy-4-oxobutoxy)-11-oxospiro[6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,1'-cyclopropane]-5-carboxylate |
| SMILES | C=CCOC(=O)N1c2cc(OCCCC(=O)OC)c(OC)cc2C(=O)N2CCCC2C12CC2 |
| InChI | InChI=1S/C24H30N2O7/c1-4-12-33-23(29)26-17-15-19(32-13-6-8-21(27)31-3)18(30-2)14-16(17)22(28)25-11-5-7-20(25)24(26)9-10-24/h4,14-15,20H,1,5-13H2,2-3H3 |
| InChIKey | BXDMPAQAUYOXOQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|