C22H19N5O4S — CID 145330144
ethane;7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 145330144) has the molecular formula C22H19N5O4S and a molecular weight of 449.49 g/mol. Its IUPAC name is ethane;7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | ethane;7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 145330144 |
| Molecular Formula | C22H19N5O4S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | ethane;7-(4-methyl-2-phenoxypyrimidin-5-yl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | CC.Cc1nc(Oc2ccccc2)ncc1N1C(=O)Nc2c(C(=O)O)sc3nccc1c23 |
| InChI | InChI=1S/C20H13N5O4S.C2H6/c1-10-13(9-22-19(23-10)29-11-5-3-2-4-6-11)25-12-7-8-21-17-14(12)15(24-20(25)28)16(30-17)18(26)27;1-2/h2-9H,1H3,(H,24,28)(H,26,27);1-2H3 |
| InChIKey | KFTPHVYHHRLXRN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |