C27H23BN5O3S — CID 163692908
CID 163692908 (PubChem CID 163692908) has the molecular formula C27H23BN5O3S and a molecular weight of 508.39 g/mol.
| Compound Name | CID 163692908 |
|---|---|
| PubChem CID | 163692908 |
| Molecular Formula | C27H23BN5O3S |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | — |
| SMILES | [B]=C1CCCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)nc1C |
| InChI | InChI=1S/C27H23BN5O3S/c1-15-19(11-12-21(30-15)36-16-7-3-2-4-8-16)33-20-13-14-29-26-22(20)23(32-27(33)35)24(37-26)25(34)31-18-10-6-5-9-17(18)28/h2-4,7-8,11-14,18H,5-6,9-10H2,1H3,(H,31,34)(H,32,35)/t18-/m1/s1 |
| InChIKey | RQEWILHVFIGYSP-GOSISDBHSA-N |
| XLogP | 5.49 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|