C28H32N6O3S — CID 129234370
N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(2-methyl-6-propan-2-yloxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129234370) has the molecular formula C28H32N6O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(2-methyl-6-propan-2-yloxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(2-methyl-6-propan-2-yloxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129234370 |
| Molecular Formula | C28H32N6O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N-[(1R,2S)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-7-(2-methyl-6-propan-2-yloxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=C)N[C@H]1CCCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccc(OC(C)C)nc1C |
| InChI | InChI=1S/C28H32N6O3S/c1-6-16(4)30-18-9-7-8-10-19(18)32-26(35)25-24-23-21(13-14-29-27(23)38-25)34(28(36)33-24)20-11-12-22(31-17(20)5)37-15(2)3/h6,11-15,18-19,30H,1,4,7-10H2,2-3,5H3,(H,32,35)(H,33,36)/t18-,19+/m0/s1 |
| InChIKey | MIDOGEKKQQOXEK-RBUKOAKNSA-N |
| XLogP | 5.80 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|