C28H32N6O4S — CID 129233882
N-[(1S,2R)-2-[[[7-(6-cyclobutyloxy-2-methyl-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]-hydroxymethyl]amino]cyclohexyl]prop-2-enamide (PubChem CID 129233882) has the molecular formula C28H32N6O4S and a molecular weight of 548.67 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[[7-(6-cyclobutyloxy-2-methyl-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]-hydroxymethyl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1S,2R)-2-[[[7-(6-cyclobutyloxy-2-methyl-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]-hydroxymethyl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 129233882 |
| Molecular Formula | C28H32N6O4S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[(1S,2R)-2-[[[7-(6-cyclobutyloxy-2-methyl-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]-hydroxymethyl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1NC(O)c1sc2nccc3c2c1NC(=O)N3c1ccc(OC2CCC2)nc1C |
| InChI | InChI=1S/C28H32N6O4S/c1-3-21(35)31-17-9-4-5-10-18(17)32-26(36)25-24-23-20(13-14-29-27(23)39-25)34(28(37)33-24)19-11-12-22(30-15(19)2)38-16-7-6-8-16/h3,11-14,16-18,26,32,36H,1,4-10H2,2H3,(H,31,35)(H,33,37)/t17-,18+,26?/m0/s1 |
| InChIKey | KNZDOCXEYMEFIJ-NJNVLPOUSA-N |
| XLogP | 4.81 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|