C20H13N5O4S — CID 130475639
7-(2-methyl-4-pyrimidin-5-yloxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 130475639) has the molecular formula C20H13N5O4S and a molecular weight of 419.42 g/mol. Its IUPAC name is 7-(2-methyl-4-pyrimidin-5-yloxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | 7-(2-methyl-4-pyrimidin-5-yloxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 130475639 |
| Molecular Formula | C20H13N5O4S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 7-(2-methyl-4-pyrimidin-5-yloxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | Cc1cc(Oc2cncnc2)ccc1N1C(=O)Nc2c(C(=O)O)sc3nccc1c23 |
| InChI | InChI=1S/C20H13N5O4S/c1-10-6-11(29-12-7-21-9-22-8-12)2-3-13(10)25-14-4-5-23-18-15(14)16(24-20(25)28)17(30-18)19(26)27/h2-9H,1H3,(H,24,28)(H,26,27) |
| InChIKey | UQKAYGSPLXGFNO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |