C28H27N5O4S — CID 129220199
7-(2-methyl-4-phenoxyphenyl)-N-(2-morpholin-4-ylethyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129220199) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is 7-(2-methyl-4-phenoxyphenyl)-N-(2-morpholin-4-ylethyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(2-methyl-4-phenoxyphenyl)-N-(2-morpholin-4-ylethyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129220199 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 7-(2-methyl-4-phenoxyphenyl)-N-(2-morpholin-4-ylethyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)NCCN3CCOCC3)sc3nccc1c23 |
| InChI | InChI=1S/C28H27N5O4S/c1-18-17-20(37-19-5-3-2-4-6-19)7-8-21(18)33-22-9-10-30-27-23(22)24(31-28(33)35)25(38-27)26(34)29-11-12-32-13-15-36-16-14-32/h2-10,17H,11-16H2,1H3,(H,29,34)(H,31,35) |
| InChIKey | SYZNLIMYEGMGIN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |