C11H19N3 — CID 145331040
1-ethenyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-imine (PubChem CID 145331040) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-ethenyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-imine.
| Compound Name | 1-ethenyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-imine |
|---|---|
| PubChem CID | 145331040 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-ethenyl-N-methyl-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-imine |
| SMILES | C=CN1/C(=N/C)CCC2CNCCC21 |
| InChI | InChI=1S/C11H19N3/c1-3-14-10-6-7-13-8-9(10)4-5-11(14)12-2/h3,9-10,13H,1,4-8H2,2H3/b12-11+ |
| InChIKey | FZDRRHKFUIRPBP-VAWYXSNFSA-N |
| XLogP | 1.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|