C23H31NO5S — CID 145332825
ethane;7-[3-(4-methoxy-3-nitrophenyl)propyl]-6-propoxy-2,3-dihydro-1,4-benzoxathiine (PubChem CID 145332825) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is ethane;7-[3-(4-methoxy-3-nitrophenyl)propyl]-6-propoxy-2,3-dihydro-1,4-benzoxathiine.
| Compound Name | ethane;7-[3-(4-methoxy-3-nitrophenyl)propyl]-6-propoxy-2,3-dihydro-1,4-benzoxathiine |
|---|---|
| PubChem CID | 145332825 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | ethane;7-[3-(4-methoxy-3-nitrophenyl)propyl]-6-propoxy-2,3-dihydro-1,4-benzoxathiine |
| SMILES | CC.CCCOc1cc2c(cc1CCCc1ccc(OC)c([N+](=O)[O-])c1)OCCS2 |
| InChI | InChI=1S/C21H25NO5S.C2H6/c1-3-9-26-19-14-21-20(27-10-11-28-21)13-16(19)6-4-5-15-7-8-18(25-2)17(12-15)22(23)24;1-2/h7-8,12-14H,3-6,9-11H2,1-2H3;1-2H3 |
| InChIKey | JEKWIASPXZYSCP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|