C21H27NO3S — CID 129262246
2-methoxy-5-[3-(6-propoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)propyl]aniline (PubChem CID 129262246) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-methoxy-5-[3-(6-propoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)propyl]aniline.
| Compound Name | 2-methoxy-5-[3-(6-propoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)propyl]aniline |
|---|---|
| PubChem CID | 129262246 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-methoxy-5-[3-(6-propoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)propyl]aniline |
| SMILES | CCCOc1cc2c(cc1CCCc1ccc(OC)c(N)c1)OCCS2 |
| InChI | InChI=1S/C21H27NO3S/c1-3-9-24-19-14-21-20(25-10-11-26-21)13-16(19)6-4-5-15-7-8-18(23-2)17(22)12-15/h7-8,12-14H,3-6,9-11,22H2,1-2H3 |
| InChIKey | NKILRAACFNMMFR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|