C24H24N4O4 — CID 145336303
N-[4-[3-cyano-4-(oxan-4-yloxy)phenyl]-2-pyridinyl]formamide;5-cyclopropyl-1,2-oxazole (PubChem CID 145336303) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[4-[3-cyano-4-(oxan-4-yloxy)phenyl]-2-pyridinyl]formamide;5-cyclopropyl-1,2-oxazole.
| Compound Name | N-[4-[3-cyano-4-(oxan-4-yloxy)phenyl]-2-pyridinyl]formamide;5-cyclopropyl-1,2-oxazole |
|---|---|
| PubChem CID | 145336303 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[4-[3-cyano-4-(oxan-4-yloxy)phenyl]-2-pyridinyl]formamide;5-cyclopropyl-1,2-oxazole |
| SMILES | N#Cc1cc(-c2ccnc(NC=O)c2)ccc1OC1CCOCC1.c1cc(C2CC2)on1 |
| InChI | InChI=1S/C18H17N3O3.C6H7NO/c19-11-15-9-13(14-3-6-20-18(10-14)21-12-22)1-2-17(15)24-16-4-7-23-8-5-16;1-2-5(1)6-3-4-7-8-6/h1-3,6,9-10,12,16H,4-5,7-8H2,(H,20,21,22);3-5H,1-2H2 |
| InChIKey | MMFSWJZQZJGAGY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|