C16H26N8O — CID 145336714
2-[amino-[(E)-2-amino-2-[[4-(1-cyclopropylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]ethenyl]amino]propan-1-ol (PubChem CID 145336714) has the molecular formula C16H26N8O and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-[amino-[(E)-2-amino-2-[[4-(1-cyclopropylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]ethenyl]amino]propan-1-ol.
| Compound Name | 2-[amino-[(E)-2-amino-2-[[4-(1-cyclopropylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]ethenyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 145336714 |
| Molecular Formula | C16H26N8O |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-[amino-[(E)-2-amino-2-[[4-(1-cyclopropylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]ethenyl]amino]propan-1-ol |
| SMILES | CC(Nc1nc(N/C(N)=C/N(N)C(C)CO)nc2[nH]ccc12)C1CC1 |
| InChI | InChI=1S/C16H26N8O/c1-9(8-25)24(18)7-13(17)21-16-22-14-12(5-6-19-14)15(23-16)20-10(2)11-3-4-11/h5-7,9-11,25H,3-4,8,17-18H2,1-2H3,(H3,19,20,21,22,23)/b13-7+ |
| InChIKey | WGSJOYKCLISEKA-NTUHNPAUSA-N |
| XLogP | 0.89 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|