About (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone
(2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone (PubChem CID 145336946) has the molecular formula C14H9Br3O3
and a molecular weight of 464.94 g/mol. Its IUPAC name is (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone |
| PubChem CID | 145336946 |
| Molecular Formula | C14H9Br3O3 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 461.81 |
| IUPAC Name | (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone |
| SMILES | Cc1ccc(Br)c(C(=O)c2c(O)c(O)cc(Br)c2Br)c1 |
| InChI | InChI=1S/C14H9Br3O3/c1-6-2-3-8(15)7(4-6)13(19)11-12(17)9(16)5-10(18)14(11)20/h2-5,18,20H,1H3 |
| InChIKey | BGHDPDALAJXEGO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone?
The IUPAC name of (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone (CID 145336946) is (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone.
What is the SMILES notation for (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone?
The canonical SMILES for (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone is Cc1ccc(Br)c(C(=O)c2c(O)c(O)cc(Br)c2Br)c1.
What is the InChIKey of (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone?
The InChIKey is BGHDPDALAJXEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Br3O3/c1-6-2-3-8(15)7(4-6)13(19)11-12(17)9(16)5-10(18)14(11)20/h2-5,18,20H,1H3.
What are the key properties of (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone?
(2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone has a molecular weight of 464.94 g/mol, XLogP of 4.92, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-5-methylphenyl)-(2,3-dibromo-5,6-dihydroxyphenyl)methanone is sourced from PubChem (CID 145336946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).