C31H34F3NO3 — CID 145337044
2-ethylhexyl 4-(N-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]anilino)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 145337044) has the molecular formula C31H34F3NO3 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-ethylhexyl 4-(N-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]anilino)cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | 2-ethylhexyl 4-(N-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]anilino)cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 145337044 |
| Molecular Formula | C31H34F3NO3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-ethylhexyl 4-(N-[(Z)-4,4,4-trifluoro-3-oxo-2-phenylbut-1-enyl]anilino)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCCCC(CC)COC(=O)C1=CCC(N(/C=C(\C(=O)C(F)(F)F)c2ccccc2)c2ccccc2)C=C1 |
| InChI | InChI=1S/C31H34F3NO3/c1-3-5-12-23(4-2)22-38-30(37)25-17-19-27(20-18-25)35(26-15-10-7-11-16-26)21-28(29(36)31(32,33)34)24-13-8-6-9-14-24/h6-11,13-19,21,23,27H,3-5,12,20,22H2,1-2H3/b28-21- |
| InChIKey | IKMATTCCUBYVBV-HFTWOUSFSA-N |
| XLogP | 7.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|