C10H14N2O — CID 145337869
6-ethenyl-2-methyl-4,5,6,7-tetrahydroindazol-7-ol (PubChem CID 145337869) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-ethenyl-2-methyl-4,5,6,7-tetrahydroindazol-7-ol.
| Compound Name | 6-ethenyl-2-methyl-4,5,6,7-tetrahydroindazol-7-ol |
|---|---|
| PubChem CID | 145337869 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 6-ethenyl-2-methyl-4,5,6,7-tetrahydroindazol-7-ol |
| SMILES | C=CC1CCc2cn(C)nc2C1O |
| InChI | InChI=1S/C10H14N2O/c1-3-7-4-5-8-6-12(2)11-9(8)10(7)13/h3,6-7,10,13H,1,4-5H2,2H3 |
| InChIKey | PECKEDVVHUDUCZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|