C17H34N2 — CID 145338101
1-N,1-N'-dicyclohexyl-1-N'-methylethene-1,1-diamine;ethane (PubChem CID 145338101) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-N,1-N'-dicyclohexyl-1-N'-methylethene-1,1-diamine;ethane.
| Compound Name | 1-N,1-N'-dicyclohexyl-1-N'-methylethene-1,1-diamine;ethane |
|---|---|
| PubChem CID | 145338101 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 1-N,1-N'-dicyclohexyl-1-N'-methylethene-1,1-diamine;ethane |
| SMILES | C=C(NC1CCCCC1)N(C)C1CCCCC1.CC |
| InChI | InChI=1S/C15H28N2.C2H6/c1-13(16-14-9-5-3-6-10-14)17(2)15-11-7-4-8-12-15;1-2/h14-16H,1,3-12H2,2H3;1-2H3 |
| InChIKey | JLUDJWWZKXXVNJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |