C22H24ClN — CID 145340614
3-[(1Z,3E)-5-(4-chlorophenyl)-4-methylpenta-1,3-dienyl]-1H-indole;ethane (PubChem CID 145340614) has the molecular formula C22H24ClN and a molecular weight of 337.89 g/mol. Its IUPAC name is 3-[(1Z,3E)-5-(4-chlorophenyl)-4-methylpenta-1,3-dienyl]-1H-indole;ethane.
| Compound Name | 3-[(1Z,3E)-5-(4-chlorophenyl)-4-methylpenta-1,3-dienyl]-1H-indole;ethane |
|---|---|
| PubChem CID | 145340614 |
| Molecular Formula | C22H24ClN |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 3-[(1Z,3E)-5-(4-chlorophenyl)-4-methylpenta-1,3-dienyl]-1H-indole;ethane |
| SMILES | C/C(=C\C=C/c1c[nH]c2ccccc12)Cc1ccc(Cl)cc1.CC |
| InChI | InChI=1S/C20H18ClN.C2H6/c1-15(13-16-9-11-18(21)12-10-16)5-4-6-17-14-22-20-8-3-2-7-19(17)20;1-2/h2-12,14,22H,13H2,1H3;1-2H3/b6-4-,15-5+; |
| InChIKey | JZQOLZSYNILOFQ-XNDXWMNFSA-N |
| XLogP | 7.05 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|