C55H42N2 — CID 145340858
4-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-2-[(Z)-3-[(2S)-2-methyl-2H-pyrrol-5-yl]-1-phenylprop-1-enyl]aniline (PubChem CID 145340858) has the molecular formula C55H42N2 and a molecular weight of 730.96 g/mol. Its IUPAC name is 4-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-2-[(Z)-3-[(2S)-2-methyl-2H-pyrrol-5-yl]-1-phenylprop-1-enyl]aniline.
| Compound Name | 4-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-2-[(Z)-3-[(2S)-2-methyl-2H-pyrrol-5-yl]-1-phenylprop-1-enyl]aniline |
|---|---|
| PubChem CID | 145340858 |
| Molecular Formula | C55H42N2 |
| Molecular Weight | 730.96 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | 4-[6-(9,9-diphenylfluoren-2-yl)naphthalen-2-yl]-2-[(Z)-3-[(2S)-2-methyl-2H-pyrrol-5-yl]-1-phenylprop-1-enyl]aniline |
| SMILES | C[C@H]1C=CC(C/C=C(/c2ccccc2)c2cc(-c3ccc4cc(-c5ccc6c(c5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)ccc4c3)ccc2N)=N1 |
| InChI | InChI=1S/C55H42N2/c1-37-21-28-47(57-37)29-31-48(38-13-5-2-6-14-38)51-35-43(27-32-54(51)56)41-24-22-40-34-42(25-23-39(40)33-41)44-26-30-50-49-19-11-12-20-52(49)55(53(50)36-44,45-15-7-3-8-16-45)46-17-9-4-10-18-46/h2-28,30-37H,29,56H2,1H3/b48-31-/t37-/m0/s1 |
| InChIKey | UCOWDPUUAYXBEP-QTNLOUTRSA-N |
| XLogP | 13.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.96 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|