About (4-aminophenyl) ethanimidate
(4-aminophenyl) ethanimidate (PubChem CID 145343014) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is (4-aminophenyl) ethanimidate.
Molecular Properties
| Compound Name | (4-aminophenyl) ethanimidate |
| PubChem CID | 145343014 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (4-aminophenyl) ethanimidate |
| SMILES | [H]/N=C(\C)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C8H10N2O/c1-6(9)11-8-4-2-7(10)3-5-8/h2-5,9H,10H2,1H3/b9-6+ |
| InChIKey | BAILXBPQVVZTJC-RMKNXTFCSA-N |
| XLogP | 1.64 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) ethanimidate?
The IUPAC name of (4-aminophenyl) ethanimidate (CID 145343014) is (4-aminophenyl) ethanimidate.
What is the SMILES notation for (4-aminophenyl) ethanimidate?
The canonical SMILES for (4-aminophenyl) ethanimidate is [H]/N=C(\C)Oc1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl) ethanimidate?
The InChIKey is BAILXBPQVVZTJC-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H10N2O/c1-6(9)11-8-4-2-7(10)3-5-8/h2-5,9H,10H2,1H3/b9-6+.
What are the key properties of (4-aminophenyl) ethanimidate?
(4-aminophenyl) ethanimidate has a molecular weight of 150.18 g/mol, XLogP of 1.64, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) ethanimidate is sourced from PubChem (CID 145343014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).