C25H19FN8O — CID 145343896
(Z)-3-(cyanoamino)-N'-[4-[7-cyano-1-[2-(2-fluorophenyl)acetyl]-2,3-dihydroindol-5-yl]pyrimidin-2-yl]prop-2-enimidamide (PubChem CID 145343896) has the molecular formula C25H19FN8O and a molecular weight of 466.48 g/mol. Its IUPAC name is (Z)-3-(cyanoamino)-N'-[4-[7-cyano-1-[2-(2-fluorophenyl)acetyl]-2,3-dihydroindol-5-yl]pyrimidin-2-yl]prop-2-enimidamide.
| Compound Name | (Z)-3-(cyanoamino)-N'-[4-[7-cyano-1-[2-(2-fluorophenyl)acetyl]-2,3-dihydroindol-5-yl]pyrimidin-2-yl]prop-2-enimidamide |
|---|---|
| PubChem CID | 145343896 |
| Molecular Formula | C25H19FN8O |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (Z)-3-(cyanoamino)-N'-[4-[7-cyano-1-[2-(2-fluorophenyl)acetyl]-2,3-dihydroindol-5-yl]pyrimidin-2-yl]prop-2-enimidamide |
| SMILES | N#CN/C=C\C(N)=N/c1nccc(-c2cc(C#N)c3c(c2)CCN3C(=O)Cc2ccccc2F)n1 |
| InChI | InChI=1S/C25H19FN8O/c26-20-4-2-1-3-16(20)13-23(35)34-10-7-17-11-18(12-19(14-27)24(17)34)21-5-9-31-25(32-21)33-22(29)6-8-30-15-28/h1-6,8-9,11-12,30H,7,10,13H2,(H2,29,31,32,33)/b8-6- |
| InChIKey | CXEJFYPZQLRAJW-VURMDHGXSA-N |
| XLogP | 2.86 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|