C26H20ClN7O — CID 130204740
(1E)-1-[1-[1-[2-(2-chlorophenyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]ethylidene]-2-(2-cyano-4-pyridinyl)guanidine (PubChem CID 130204740) has the molecular formula C26H20ClN7O and a molecular weight of 481.95 g/mol. Its IUPAC name is (1E)-1-[1-[1-[2-(2-chlorophenyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]ethylidene]-2-(2-cyano-4-pyridinyl)guanidine.
| Compound Name | (1E)-1-[1-[1-[2-(2-chlorophenyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]ethylidene]-2-(2-cyano-4-pyridinyl)guanidine |
|---|---|
| PubChem CID | 130204740 |
| Molecular Formula | C26H20ClN7O |
| Molecular Weight | 481.95 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (1E)-1-[1-[1-[2-(2-chlorophenyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]ethylidene]-2-(2-cyano-4-pyridinyl)guanidine |
| SMILES | C/C(=N\C(N)=N\c1ccnc(C#N)c1)c1cc(C#N)c2c(c1)CCN2C(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C26H20ClN7O/c1-16(32-26(30)33-21-6-8-31-22(13-21)15-29)19-10-18-7-9-34(25(18)20(11-19)14-28)24(35)12-17-4-2-3-5-23(17)27/h2-6,8,10-11,13H,7,9,12H2,1H3,(H2,30,31,33)/b32-16+ |
| InChIKey | ISBXGOQMESQVLQ-KPGMTVGESA-N |
| XLogP | 4.07 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|