C26H31ClN6O2 — CID 145343966
(1E)-1-[1-[1-[2-(2-chloro-3-pyridinyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]propylidene]-2-methyl-3-(oxetan-3-yl)guanidine;ethane (PubChem CID 145343966) has the molecular formula C26H31ClN6O2 and a molecular weight of 495.03 g/mol. Its IUPAC name is (1E)-1-[1-[1-[2-(2-chloro-3-pyridinyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]propylidene]-2-methyl-3-(oxetan-3-yl)guanidine;ethane.
| Compound Name | (1E)-1-[1-[1-[2-(2-chloro-3-pyridinyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]propylidene]-2-methyl-3-(oxetan-3-yl)guanidine;ethane |
|---|---|
| PubChem CID | 145343966 |
| Molecular Formula | C26H31ClN6O2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (1E)-1-[1-[1-[2-(2-chloro-3-pyridinyl)acetyl]-7-cyano-2,3-dihydroindol-5-yl]propylidene]-2-methyl-3-(oxetan-3-yl)guanidine;ethane |
| SMILES | CC.CC/C(=N\C(=N\C)NC1COC1)c1cc(C#N)c2c(c1)CCN2C(=O)Cc1cccnc1Cl |
| InChI | InChI=1S/C24H25ClN6O2.C2H6/c1-3-20(30-24(27-2)29-19-13-33-14-19)17-9-15-6-8-31(22(15)18(10-17)12-26)21(32)11-16-5-4-7-28-23(16)25;1-2/h4-5,7,9-10,19H,3,6,8,11,13-14H2,1-2H3,(H,27,29);1-2H3/b30-20+; |
| InChIKey | AOJKMYRXUXYQRH-BNCTYUPTSA-N |
| XLogP | 3.94 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|