C22H15BrClN3O — CID 150444694
5-(2-bromo-4-pyridinyl)-1-[2-(2-chlorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile (PubChem CID 150444694) has the molecular formula C22H15BrClN3O and a molecular weight of 452.74 g/mol. Its IUPAC name is 5-(2-bromo-4-pyridinyl)-1-[2-(2-chlorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile.
| Compound Name | 5-(2-bromo-4-pyridinyl)-1-[2-(2-chlorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 150444694 |
| Molecular Formula | C22H15BrClN3O |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 5-(2-bromo-4-pyridinyl)-1-[2-(2-chlorophenyl)acetyl]-2,3-dihydroindole-7-carbonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Br)c2)cc2c1N(C(=O)Cc1ccccc1Cl)CC2 |
| InChI | InChI=1S/C22H15BrClN3O/c23-20-11-14(5-7-26-20)17-9-16-6-8-27(22(16)18(10-17)13-25)21(28)12-15-3-1-2-4-19(15)24/h1-5,7,9-11H,6,8,12H2 |
| InChIKey | HMMZYQCTCQLKOO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|