C20H30FNO5 — CID 145346526
tert-butyl N-[(3S)-9-methyl-2-oxooxonan-3-yl]carbamate;4-fluorophenol (PubChem CID 145346526) has the molecular formula C20H30FNO5 and a molecular weight of 383.46 g/mol. Its IUPAC name is tert-butyl N-[(3S)-9-methyl-2-oxooxonan-3-yl]carbamate;4-fluorophenol.
| Compound Name | tert-butyl N-[(3S)-9-methyl-2-oxooxonan-3-yl]carbamate;4-fluorophenol |
|---|---|
| PubChem CID | 145346526 |
| Molecular Formula | C20H30FNO5 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl N-[(3S)-9-methyl-2-oxooxonan-3-yl]carbamate;4-fluorophenol |
| SMILES | CC1CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)O1.Oc1ccc(F)cc1 |
| InChI | InChI=1S/C14H25NO4.C6H5FO/c1-10-8-6-5-7-9-11(12(16)18-10)15-13(17)19-14(2,3)4;7-5-1-3-6(8)4-2-5/h10-11H,5-9H2,1-4H3,(H,15,17);1-4,8H/t10?,11-;/m0./s1 |
| InChIKey | UUZKHPSYJAZWNK-GQNCZFCYSA-N |
| XLogP | 4.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |