C22H37NO5 — CID 145114881
tert-butyl N-[(3S)-8-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-10-methyl-2-oxooxecan-3-yl]carbamate (PubChem CID 145114881) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is tert-butyl N-[(3S)-8-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-10-methyl-2-oxooxecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-8-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-10-methyl-2-oxooxecan-3-yl]carbamate |
|---|---|
| PubChem CID | 145114881 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | tert-butyl N-[(3S)-8-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-10-methyl-2-oxooxecan-3-yl]carbamate |
| SMILES | C/C=C\C=C(/CC)OC1CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)C1 |
| InChI | InChI=1S/C22H37NO5/c1-7-9-12-17(8-2)27-18-13-10-11-14-19(20(24)26-16(3)15-18)23-21(25)28-22(4,5)6/h7,9,12,16,18-19H,8,10-11,13-15H2,1-6H3,(H,23,25)/b9-7-,17-12+/t16?,18?,19-/m0/s1 |
| InChIKey | OGSRDZJEWRDJEW-XWHWRWHCSA-N |
| XLogP | 5.03 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|