C23H27FN2O6 — CID 145346527
N-[(3S,4R,9S)-4-(4-fluorophenoxy)-3-methyl-2,11-dioxabicyclo[8.1.0]undecan-9-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide (PubChem CID 145346527) has the molecular formula C23H27FN2O6 and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[(3S,4R,9S)-4-(4-fluorophenoxy)-3-methyl-2,11-dioxabicyclo[8.1.0]undecan-9-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide.
| Compound Name | N-[(3S,4R,9S)-4-(4-fluorophenoxy)-3-methyl-2,11-dioxabicyclo[8.1.0]undecan-9-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 145346527 |
| Molecular Formula | C23H27FN2O6 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[(3S,4R,9S)-4-(4-fluorophenoxy)-3-methyl-2,11-dioxabicyclo[8.1.0]undecan-9-yl]-3-hydroxy-4-methoxypyridine-2-carboxamide |
| SMILES | COc1ccnc(C(=O)N[C@H]2CCCC[C@@H](Oc3ccc(F)cc3)[C@H](C)OC3OC32)c1O |
| InChI | InChI=1S/C23H27FN2O6/c1-13-17(31-15-9-7-14(24)8-10-15)6-4-3-5-16(21-23(30-13)32-21)26-22(28)19-20(27)18(29-2)11-12-25-19/h7-13,16-17,21,23,27H,3-6H2,1-2H3,(H,26,28)/t13-,16-,17+,21?,23?/m0/s1 |
| InChIKey | JNQNDDRTZYFHCL-YEQUODFDSA-N |
| XLogP | 3.18 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|