C46H46S4 — CID 145347045
2-ethyl-5-[2-ethyl-5,10-bis(5-ethylthiophen-2-yl)-7-methyl-9-[5-(2-methylbutan-2-yl)thiophen-2-yl]pyren-4-yl]thiophene (PubChem CID 145347045) has the molecular formula C46H46S4 and a molecular weight of 727.14 g/mol. Its IUPAC name is 2-ethyl-5-[2-ethyl-5,10-bis(5-ethylthiophen-2-yl)-7-methyl-9-[5-(2-methylbutan-2-yl)thiophen-2-yl]pyren-4-yl]thiophene.
| Compound Name | 2-ethyl-5-[2-ethyl-5,10-bis(5-ethylthiophen-2-yl)-7-methyl-9-[5-(2-methylbutan-2-yl)thiophen-2-yl]pyren-4-yl]thiophene |
|---|---|
| PubChem CID | 145347045 |
| Molecular Formula | C46H46S4 |
| Molecular Weight | 727.14 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | 2-ethyl-5-[2-ethyl-5,10-bis(5-ethylthiophen-2-yl)-7-methyl-9-[5-(2-methylbutan-2-yl)thiophen-2-yl]pyren-4-yl]thiophene |
| SMILES | CCc1cc2c(-c3ccc(CC)s3)c(-c3ccc(CC)s3)c3cc(C)cc4c(-c5ccc(C(C)(C)CC)s5)c(-c5ccc(CC)s5)c(c1)c2c34 |
| InChI | InChI=1S/C46H46S4/c1-9-27-24-33-41-34(25-27)45(37-19-16-30(12-4)49-37)43(38-20-21-39(50-38)46(7,8)13-5)32-23-26(6)22-31(40(32)41)42(35-17-14-28(10-2)47-35)44(33)36-18-15-29(11-3)48-36/h14-25H,9-13H2,1-8H3 |
| InChIKey | BRCAHDUVXTVKMG-UHFFFAOYSA-N |
| XLogP | 15.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.14 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|