C27H26N2 — CID 145347618
9-cyclohex-2-en-1-yl-10,11-bis[(Z)-prop-1-enyl]indolo[5,4-h]quinoline (PubChem CID 145347618) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 9-cyclohex-2-en-1-yl-10,11-bis[(Z)-prop-1-enyl]indolo[5,4-h]quinoline.
| Compound Name | 9-cyclohex-2-en-1-yl-10,11-bis[(Z)-prop-1-enyl]indolo[5,4-h]quinoline |
|---|---|
| PubChem CID | 145347618 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 9-cyclohex-2-en-1-yl-10,11-bis[(Z)-prop-1-enyl]indolo[5,4-h]quinoline |
| SMILES | C/C=C\c1c(/C=C\C)n(C2C=CCCC2)c2ccc3ccc4cccnc4c3c12 |
| InChI | InChI=1S/C27H26N2/c1-3-9-22-23(10-4-2)29(21-12-6-5-7-13-21)24-17-16-19-14-15-20-11-8-18-28-27(20)25(19)26(22)24/h3-4,6,8-12,14-18,21H,5,7,13H2,1-2H3/b9-3-,10-4- |
| InChIKey | HTSYRHZCMPBOIM-UIYSNZQUSA-N |
| XLogP | 7.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|