C15H22N3O8P — CID 14535080
[(1R)-1-[(3,5-dinitrobenzoyl)amino]octyl]phosphonic acid (PubChem CID 14535080) has the molecular formula C15H22N3O8P and a molecular weight of 403.33 g/mol. Its IUPAC name is [(1R)-1-[(3,5-dinitrobenzoyl)amino]octyl]phosphonic acid.
| Compound Name | [(1R)-1-[(3,5-dinitrobenzoyl)amino]octyl]phosphonic acid |
|---|---|
| PubChem CID | 14535080 |
| Molecular Formula | C15H22N3O8P |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [(1R)-1-[(3,5-dinitrobenzoyl)amino]octyl]phosphonic acid |
| SMILES | CCCCCCC[C@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)P(=O)(O)O |
| InChI | InChI=1S/C15H22N3O8P/c1-2-3-4-5-6-7-14(27(24,25)26)16-15(19)11-8-12(17(20)21)10-13(9-11)18(22)23/h8-10,14H,2-7H2,1H3,(H,16,19)(H2,24,25,26)/t14-/m1/s1 |
| InChIKey | TWRDIHXAERMTTA-CQSZACIVSA-N |
| XLogP | 3.10 |
| TPSA | 172.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|