C32H34O6 — CID 145350911
[4-[4-(7-formyl-5-methoxyoct-7-enoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 145350911) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is [4-[4-(7-formyl-5-methoxyoct-7-enoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[4-(7-formyl-5-methoxyoct-7-enoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 145350911 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [4-[4-(7-formyl-5-methoxyoct-7-enoxy)phenyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | C=C(C=O)CC(CCCCOc1ccc(-c2ccc(OC(=O)/C=C/c3ccc(OC)cc3)cc2)cc1)OC |
| InChI | InChI=1S/C32H34O6/c1-24(23-33)22-31(36-3)6-4-5-21-37-29-16-10-26(11-17-29)27-12-18-30(19-13-27)38-32(34)20-9-25-7-14-28(35-2)15-8-25/h7-20,23,31H,1,4-6,21-22H2,2-3H3/b20-9+ |
| InChIKey | OKHYVHXTVYGCML-AWQFTUOYSA-N |
| XLogP | 6.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|