C30H33N5O3 — CID 145351775
N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(3-methylpiperazin-1-yl)benzamide;N-methylmethanamine (PubChem CID 145351775) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(3-methylpiperazin-1-yl)benzamide;N-methylmethanamine.
| Compound Name | N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(3-methylpiperazin-1-yl)benzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 145351775 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(3-methylpiperazin-1-yl)benzamide;N-methylmethanamine |
| SMILES | CC1CN(c2ccc(C(=O)Nc3cc(Oc4ccc5c(C=O)cccc5c4)ccn3)cc2)CCN1.CNC |
| InChI | InChI=1S/C28H26N4O3.C2H7N/c1-19-17-32(14-13-29-19)23-7-5-20(6-8-23)28(34)31-27-16-25(11-12-30-27)35-24-9-10-26-21(15-24)3-2-4-22(26)18-33;1-3-2/h2-12,15-16,18-19,29H,13-14,17H2,1H3,(H,30,31,34);3H,1-2H3 |
| InChIKey | HTVOPYKXXUIYHP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|