C31H34N4O4 — CID 145351744
N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide;N-methylmethanamine (PubChem CID 145351744) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide;N-methylmethanamine.
| Compound Name | N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 145351744 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | N-[4-(5-formylnaphthalen-2-yl)oxy-2-pyridinyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide;N-methylmethanamine |
| SMILES | CNC.O=Cc1cccc2cc(Oc3ccnc(NC(=O)c4ccc(OCCN5CCCC5)cc4)c3)ccc12 |
| InChI | InChI=1S/C29H27N3O4.C2H7N/c33-20-23-5-3-4-22-18-25(10-11-27(22)23)36-26-12-13-30-28(19-26)31-29(34)21-6-8-24(9-7-21)35-17-16-32-14-1-2-15-32;1-3-2/h3-13,18-20H,1-2,14-17H2,(H,30,31,34);3H,1-2H3 |
| InChIKey | KKQFLDAYEAGAPC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|