C32H40N4O3 — CID 70206920
N-[2-amino-3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]phenyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide (PubChem CID 70206920) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is N-[2-amino-3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]phenyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide.
| Compound Name | N-[2-amino-3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]phenyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 70206920 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | N-[2-amino-3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]phenyl]-4-(2-pyrrolidin-1-ylethoxy)benzamide |
| SMILES | Nc1c(Cc2ccc(OCCN3CCCC3)cc2)cccc1NC(=O)c1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C32H40N4O3/c33-31-27(24-25-8-12-28(13-9-25)38-22-20-35-16-1-2-17-35)6-5-7-30(31)34-32(37)26-10-14-29(15-11-26)39-23-21-36-18-3-4-19-36/h5-15H,1-4,16-24,33H2,(H,34,37) |
| InChIKey | IBPJQQNVGWPRFA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|