C20H22FIN2O2 — CID 166090288
N-(5-fluoro-2-iodophenyl)-4-(2-piperidin-1-ylethoxy)benzamide (PubChem CID 166090288) has the molecular formula C20H22FIN2O2 and a molecular weight of 468.31 g/mol. Its IUPAC name is N-(5-fluoro-2-iodophenyl)-4-(2-piperidin-1-ylethoxy)benzamide.
| Compound Name | N-(5-fluoro-2-iodophenyl)-4-(2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 166090288 |
| Molecular Formula | C20H22FIN2O2 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | N-(5-fluoro-2-iodophenyl)-4-(2-piperidin-1-ylethoxy)benzamide |
| SMILES | O=C(Nc1cc(F)ccc1I)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22FIN2O2/c21-16-6-9-18(22)19(14-16)23-20(25)15-4-7-17(8-5-15)26-13-12-24-10-2-1-3-11-24/h4-9,14H,1-3,10-13H2,(H,23,25) |
| InChIKey | KYRVBLSMNWCORG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|