C24H26N4O4 — CID 139434898
N-[2-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide (PubChem CID 139434898) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide.
| Compound Name | N-[2-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 139434898 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[2-(2,4-dioxo-1H-pyrimidin-6-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide |
| SMILES | O=C(Nc1ccccc1-c1cc(=O)[nH]c(=O)[nH]1)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c29-22-16-21(26-24(31)27-22)19-6-2-3-7-20(19)25-23(30)17-8-10-18(11-9-17)32-15-14-28-12-4-1-5-13-28/h2-3,6-11,16H,1,4-5,12-15H2,(H,25,30)(H2,26,27,29,31) |
| InChIKey | JDMIWCXPZAKRPW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |