C28H27N3O4 — CID 139434976
N-[2-(4,7-dioxo-1H-indol-3-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide (PubChem CID 139434976) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[2-(4,7-dioxo-1H-indol-3-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide.
| Compound Name | N-[2-(4,7-dioxo-1H-indol-3-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 139434976 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[2-(4,7-dioxo-1H-indol-3-yl)phenyl]-4-(2-piperidin-1-ylethoxy)benzamide |
| SMILES | O=C(Nc1ccccc1-c1c[nH]c2c1C(=O)C=CC2=O)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C28H27N3O4/c32-24-12-13-25(33)27-26(24)22(18-29-27)21-6-2-3-7-23(21)30-28(34)19-8-10-20(11-9-19)35-17-16-31-14-4-1-5-15-31/h2-3,6-13,18,29H,1,4-5,14-17H2,(H,30,34) |
| InChIKey | LCTAVAZHIJHRDL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|