C28H30N3O4+ — CID 166090269
methylidene-[2-(7-oxo-4,5-dihydro-1H-pyrano[3,4-b]pyrrol-3-yl)phenyl]-[4-(2-piperidin-1-ylethoxy)benzoyl]azanium (PubChem CID 166090269) has the molecular formula C28H30N3O4+ and a molecular weight of 472.57 g/mol. Its IUPAC name is methylidene-[2-(7-oxo-4,5-dihydro-1H-pyrano[3,4-b]pyrrol-3-yl)phenyl]-[4-(2-piperidin-1-ylethoxy)benzoyl]azanium.
| Compound Name | methylidene-[2-(7-oxo-4,5-dihydro-1H-pyrano[3,4-b]pyrrol-3-yl)phenyl]-[4-(2-piperidin-1-ylethoxy)benzoyl]azanium |
|---|---|
| PubChem CID | 166090269 |
| Molecular Formula | C28H30N3O4+ |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | methylidene-[2-(7-oxo-4,5-dihydro-1H-pyrano[3,4-b]pyrrol-3-yl)phenyl]-[4-(2-piperidin-1-ylethoxy)benzoyl]azanium |
| SMILES | C=[N+](C(=O)c1ccc(OCCN2CCCCC2)cc1)c1ccccc1-c1c[nH]c2c1CCOC2=O |
| InChI | InChI=1S/C28H29N3O4/c1-30(25-8-4-3-7-22(25)24-19-29-26-23(24)13-17-35-28(26)33)27(32)20-9-11-21(12-10-20)34-18-16-31-14-5-2-6-15-31/h3-4,7-12,19H,1-2,5-6,13-18H2/p+1 |
| InChIKey | JTUDWEUSZIBJGZ-UHFFFAOYSA-O |
| XLogP | 4.44 |
| TPSA | 74.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|