C14H20N2 — CID 145352404
3-ethyl-1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazole (PubChem CID 145352404) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-ethyl-1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazole.
| Compound Name | 3-ethyl-1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazole |
|---|---|
| PubChem CID | 145352404 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-ethyl-1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazole |
| SMILES | C=C/C(=C\C=C(C)C)c1cc(CC)nn1C |
| InChI | InChI=1S/C14H20N2/c1-6-12(9-8-11(3)4)14-10-13(7-2)15-16(14)5/h6,8-10H,1,7H2,2-5H3/b12-9+ |
| InChIKey | ASKWZTQUFFWQSM-FMIVXFBMSA-N |
| XLogP | 3.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|