C13H18N2O — CID 145352441
[1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazol-3-yl]methanol (PubChem CID 145352441) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is [1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazol-3-yl]methanol.
| Compound Name | [1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 145352441 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [1-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]pyrazol-3-yl]methanol |
| SMILES | C=C/C(=C\C=C(C)C)c1cc(CO)nn1C |
| InChI | InChI=1S/C13H18N2O/c1-5-11(7-6-10(2)3)13-8-12(9-16)14-15(13)4/h5-8,16H,1,9H2,2-4H3/b11-7+ |
| InChIKey | OXWDHHZPRQGXCM-YRNVUSSQSA-N |
| XLogP | 2.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|