C18H16F3N2O2S- — CID 163859978
4-[5-(6-methylhepta-1,3,5-trien-3-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinate (PubChem CID 163859978) has the molecular formula C18H16F3N2O2S- and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-[5-(6-methylhepta-1,3,5-trien-3-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinate.
| Compound Name | 4-[5-(6-methylhepta-1,3,5-trien-3-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinate |
|---|---|
| PubChem CID | 163859978 |
| Molecular Formula | C18H16F3N2O2S- |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[5-(6-methylhepta-1,3,5-trien-3-yl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfinate |
| SMILES | C=CC(=CC=C(C)C)c1cc(C(F)(F)F)nn1-c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C18H17F3N2O2S/c1-4-13(6-5-12(2)3)16-11-17(18(19,20)21)22-23(16)14-7-9-15(10-8-14)26(24)25/h4-11H,1H2,2-3H3,(H,24,25)/p-1 |
| InChIKey | OFNDSYSPMFQPGR-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|