About 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine
1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine (PubChem CID 145352647) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine.
Analyze 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine (CID 145352647) is 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine is CCC(C1=CC=CCC1)N(C)C.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
The InChIKey is LPCOWWSTSKEYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-4-11(12(2)3)10-8-6-5-7-9-10/h5-6,8,11H,4,7,9H2,1-3H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine?
1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine has a molecular weight of 165.28 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 145352647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).