C19H22N2O2 — CID 145355703
2-[(E)-pent-2-en-2-yl]pyridine;2-prop-1-en-2-ylpyridine-4-carboxylic acid (PubChem CID 145355703) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[(E)-pent-2-en-2-yl]pyridine;2-prop-1-en-2-ylpyridine-4-carboxylic acid.
| Compound Name | 2-[(E)-pent-2-en-2-yl]pyridine;2-prop-1-en-2-ylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145355703 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[(E)-pent-2-en-2-yl]pyridine;2-prop-1-en-2-ylpyridine-4-carboxylic acid |
| SMILES | C=C(C)c1cc(C(=O)O)ccn1.CC/C=C(\C)c1ccccn1 |
| InChI | InChI=1S/C10H13N.C9H9NO2/c1-3-6-9(2)10-7-4-5-8-11-10;1-6(2)8-5-7(9(11)12)3-4-10-8/h4-8H,3H2,1-2H3;3-5H,1H2,2H3,(H,11,12)/b9-6+; |
| InChIKey | TVKLXXZTUUKMBR-MLBSPLJJSA-N |
| XLogP | 4.71 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |