C13H25N3 — CID 145356794
ethane;5,7,9-trimethyl-1,4,6,7,8,9-hexahydropyrazolo[4,5-c]azocine (PubChem CID 145356794) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;5,7,9-trimethyl-1,4,6,7,8,9-hexahydropyrazolo[4,5-c]azocine.
| Compound Name | ethane;5,7,9-trimethyl-1,4,6,7,8,9-hexahydropyrazolo[4,5-c]azocine |
|---|---|
| PubChem CID | 145356794 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | ethane;5,7,9-trimethyl-1,4,6,7,8,9-hexahydropyrazolo[4,5-c]azocine |
| SMILES | CC.CC1CC(C)c2[nH]ncc2CN(C)C1 |
| InChI | InChI=1S/C11H19N3.C2H6/c1-8-4-9(2)11-10(5-12-13-11)7-14(3)6-8;1-2/h5,8-9H,4,6-7H2,1-3H3,(H,12,13);1-2H3 |
| InChIKey | BXRMOEFYAMMZSQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |