C11H16N2 — CID 101431968
(4S,7S)-7-methyl-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 101431968) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (4S,7S)-7-methyl-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | (4S,7S)-7-methyl-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 101431968 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (4S,7S)-7-methyl-4-prop-1-en-2-yl-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | C=C(C)[C@@H]1CC[C@H](C)c2[nH]ncc21 |
| InChI | InChI=1S/C11H16N2/c1-7(2)9-5-4-8(3)11-10(9)6-12-13-11/h6,8-9H,1,4-5H2,2-3H3,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | WICJRJPKCIRYKC-IUCAKERBSA-N |
| XLogP | 2.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|