C17H24O2 — CID 14864209
(1R,4S)-5,6-dimethoxy-4,7-dimethyl-1-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 14864209) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1R,4S)-5,6-dimethoxy-4,7-dimethyl-1-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,4S)-5,6-dimethoxy-4,7-dimethyl-1-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 14864209 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1R,4S)-5,6-dimethoxy-4,7-dimethyl-1-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C(C)[C@H]1CC[C@H](C)c2c1cc(C)c(OC)c2OC |
| InChI | InChI=1S/C17H24O2/c1-10(2)13-8-7-11(3)15-14(13)9-12(4)16(18-5)17(15)19-6/h9,11,13H,1,7-8H2,2-6H3/t11-,13+/m0/s1 |
| InChIKey | SDRDCRWQVIPPTL-WCQYABFASA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|